C14H9BrF3N — CID 24754439
N-[(4-bromophenyl)methyl]-1-(2,4,6-trifluorophenyl)methanimine (PubChem CID 24754439) has the molecular formula C14H9BrF3N and a molecular weight of 328.13 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1-(2,4,6-trifluorophenyl)methanimine.
| Compound Name | N-[(4-bromophenyl)methyl]-1-(2,4,6-trifluorophenyl)methanimine |
|---|---|
| PubChem CID | 24754439 |
| Molecular Formula | C14H9BrF3N |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1-(2,4,6-trifluorophenyl)methanimine |
| SMILES | Fc1cc(F)c(/C=N/Cc2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C14H9BrF3N/c15-10-3-1-9(2-4-10)7-19-8-12-13(17)5-11(16)6-14(12)18/h1-6,8H,7H2/b19-8+ |
| InChIKey | DGLKHQBJBXWSCI-UFWORHAWSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|