C14H12O2 — CID 24754941
(1R,2S,11R,12S)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one (PubChem CID 24754941) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (1R,2S,11R,12S)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one.
| Compound Name | (1R,2S,11R,12S)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one |
|---|---|
| PubChem CID | 24754941 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (1R,2S,11R,12S)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one |
| SMILES | O=C1Oc2ccccc2[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H12O2/c15-14-13-9-6-5-8(7-9)12(13)10-3-1-2-4-11(10)16-14/h1-6,8-9,12-13H,7H2/t8-,9+,12+,13+/m0/s1 |
| InChIKey | PWVJRCQQAGQYIW-HIAZDOBYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|