C11H15NO — CID 24755165
3,4,6,7,8,9-hexahydro-1H-[1,4]oxazino[4,3-a]indole (PubChem CID 24755165) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-1H-[1,4]oxazino[4,3-a]indole.
| Compound Name | 3,4,6,7,8,9-hexahydro-1H-[1,4]oxazino[4,3-a]indole |
|---|---|
| PubChem CID | 24755165 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3,4,6,7,8,9-hexahydro-1H-[1,4]oxazino[4,3-a]indole |
| SMILES | c1c2c(n3c1COCC3)CCCC2 |
| InChI | InChI=1S/C11H15NO/c1-2-4-11-9(3-1)7-10-8-13-6-5-12(10)11/h7H,1-6,8H2 |
| InChIKey | YEDSVPPFSCRNDL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |