C62H60Si2 — CID 24755418
tert-butyl-dimethyl-[3,6,9-tribenzhydrylidene-11-[tert-butyl(dimethyl)silyl]undeca-1,4,7,10-tetraynyl]silane (PubChem CID 24755418) has the molecular formula C62H60Si2 and a molecular weight of 861.33 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3,6,9-tribenzhydrylidene-11-[tert-butyl(dimethyl)silyl]undeca-1,4,7,10-tetraynyl]silane.
| Compound Name | tert-butyl-dimethyl-[3,6,9-tribenzhydrylidene-11-[tert-butyl(dimethyl)silyl]undeca-1,4,7,10-tetraynyl]silane |
|---|---|
| PubChem CID | 24755418 |
| Molecular Formula | C62H60Si2 |
| Molecular Weight | 861.33 g/mol |
| Exact Mass | 860.42 |
| IUPAC Name | tert-butyl-dimethyl-[3,6,9-tribenzhydrylidene-11-[tert-butyl(dimethyl)silyl]undeca-1,4,7,10-tetraynyl]silane |
| SMILES | CC(C)(C)[Si](C)(C)C#CC(C#CC(C#CC(C#C[Si](C)(C)C(C)(C)C)=C(c1ccccc1)c1ccccc1)=C(c1ccccc1)c1ccccc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C62H60Si2/c1-61(2,3)63(7,8)47-45-56(59(51-33-21-13-22-34-51)52-35-23-14-24-36-52)43-41-55(58(49-29-17-11-18-30-49)50-31-19-12-20-32-50)42-44-57(46-48-64(9,10)62(4,5)6)60(53-37-25-15-26-38-53)54-39-27-16-28-40-54/h11-40H,1-10H3 |
| InChIKey | JNPLQIWTUFPGCP-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.33 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|