C15H22O8 — CID 24756380
5-O-ethyl 1-O,1-O-dimethyl 4-acetyloxyhex-5-ene-1,1,5-tricarboxylate (PubChem CID 24756380) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is 5-O-ethyl 1-O,1-O-dimethyl 4-acetyloxyhex-5-ene-1,1,5-tricarboxylate.
| Compound Name | 5-O-ethyl 1-O,1-O-dimethyl 4-acetyloxyhex-5-ene-1,1,5-tricarboxylate |
|---|---|
| PubChem CID | 24756380 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-O-ethyl 1-O,1-O-dimethyl 4-acetyloxyhex-5-ene-1,1,5-tricarboxylate |
| SMILES | C=C(C(=O)OCC)C(CCC(C(=O)OC)C(=O)OC)OC(C)=O |
| InChI | InChI=1S/C15H22O8/c1-6-22-13(17)9(2)12(23-10(3)16)8-7-11(14(18)20-4)15(19)21-5/h11-12H,2,6-8H2,1,3-5H3 |
| InChIKey | CKWNVWJOITUBKY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|