About 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate
2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate (PubChem CID 143368684) has the molecular formula C19H26O8
and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate |
| PubChem CID | 143368684 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OCC1CC(CC(=C)C(=O)OCCOC(=O)CC(C)=O)CO1 |
| InChI | InChI=1S/C19H26O8/c1-12(2)18(22)27-11-16-9-15(10-26-16)7-13(3)19(23)25-6-5-24-17(21)8-14(4)20/h15-16H,1,3,5-11H2,2,4H3 |
| InChIKey | FTIHEDVMMPNTMZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate?
The IUPAC name of 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate (CID 143368684) is 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate.
What is the SMILES notation for 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate?
The canonical SMILES for 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate is C=C(C)C(=O)OCC1CC(CC(=C)C(=O)OCCOC(=O)CC(C)=O)CO1.
What is the InChIKey of 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate?
The InChIKey is FTIHEDVMMPNTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O8/c1-12(2)18(22)27-11-16-9-15(10-26-16)7-13(3)19(23)25-6-5-24-17(21)8-14(4)20/h15-16H,1,3,5-11H2,2,4H3.
What are the key properties of 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate?
2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate has a molecular weight of 382.41 g/mol, XLogP of 1.52, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[5-(2-methylprop-2-enoyloxymethyl)oxolan-3-yl]methyl]prop-2-enoyloxy]ethyl 3-oxobutanoate is sourced from PubChem (CID 143368684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).