C25H38O13 — CID 101351844
methyl 2-[[21-(2-methoxycarbonylprop-2-enyl)-20,22-dioxo-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]methyl]prop-2-enoate (PubChem CID 101351844) has the molecular formula C25H38O13 and a molecular weight of 546.57 g/mol. Its IUPAC name is methyl 2-[[21-(2-methoxycarbonylprop-2-enyl)-20,22-dioxo-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]methyl]prop-2-enoate.
| Compound Name | methyl 2-[[21-(2-methoxycarbonylprop-2-enyl)-20,22-dioxo-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 101351844 |
| Molecular Formula | C25H38O13 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | methyl 2-[[21-(2-methoxycarbonylprop-2-enyl)-20,22-dioxo-1,4,7,10,13,16,19-heptaoxacyclodocos-21-yl]methyl]prop-2-enoate |
| SMILES | C=C(CC1(CC(=C)C(=O)OC)C(=O)OCCOCCOCCOCCOCCOCCOC1=O)C(=O)OC |
| InChI | InChI=1S/C25H38O13/c1-19(21(26)30-3)17-25(18-20(2)22(27)31-4)23(28)37-15-13-35-11-9-33-7-5-32-6-8-34-10-12-36-14-16-38-24(25)29/h1-2,5-18H2,3-4H3 |
| InChIKey | CICIEXOFNUGYEL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|