C11H18O5 — CID 174975222
1,3-dioxolan-2-one;methyl 2-methylprop-2-enoate;prop-1-ene (PubChem CID 174975222) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;methyl 2-methylprop-2-enoate;prop-1-ene.
| Compound Name | 1,3-dioxolan-2-one;methyl 2-methylprop-2-enoate;prop-1-ene |
|---|---|
| PubChem CID | 174975222 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1,3-dioxolan-2-one;methyl 2-methylprop-2-enoate;prop-1-ene |
| SMILES | C=C(C)C(=O)OC.C=CC.O=C1OCCO1 |
| InChI | InChI=1S/C5H8O2.C3H4O3.C3H6/c1-4(2)5(6)7-3;4-3-5-1-2-6-3;1-3-2/h1H2,2-3H3;1-2H2;3H,1H2,2H3 |
| InChIKey | LSODMPABOOVRNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|