C18H18F3NO2 — CID 24757338
N-hydroxy-2-[4-[4-(2,4,5-trifluorophenyl)butyl]phenyl]acetamide (PubChem CID 24757338) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-hydroxy-2-[4-[4-(2,4,5-trifluorophenyl)butyl]phenyl]acetamide.
| Compound Name | N-hydroxy-2-[4-[4-(2,4,5-trifluorophenyl)butyl]phenyl]acetamide |
|---|---|
| PubChem CID | 24757338 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-hydroxy-2-[4-[4-(2,4,5-trifluorophenyl)butyl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(CCCCc2cc(F)c(F)cc2F)cc1)NO |
| InChI | InChI=1S/C18H18F3NO2/c19-15-11-17(21)16(20)10-14(15)4-2-1-3-12-5-7-13(8-6-12)9-18(23)22-24/h5-8,10-11,24H,1-4,9H2,(H,22,23) |
| InChIKey | KIXCQRJNCSXILM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|