C25H25N7O2 — CID 24760460
2-[6-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrazin-2-yl]-1H-indole-5-carboxamide (PubChem CID 24760460) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[6-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrazin-2-yl]-1H-indole-5-carboxamide.
| Compound Name | 2-[6-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrazin-2-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 24760460 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[6-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrazin-2-yl]-1H-indole-5-carboxamide |
| SMILES | CN1CCN(C(=O)c2ccc(Nc3cncc(-c4cc5cc(C(N)=O)ccc5[nH]4)n3)cc2)CC1 |
| InChI | InChI=1S/C25H25N7O2/c1-31-8-10-32(11-9-31)25(34)16-2-5-19(6-3-16)28-23-15-27-14-22(30-23)21-13-18-12-17(24(26)33)4-7-20(18)29-21/h2-7,12-15,29H,8-11H2,1H3,(H2,26,33)(H,28,30) |
| InChIKey | GMDXKZWRGGYIIL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |