C19H29N3O5 — CID 24760783
N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-2-methoxypyridine-3-carboxamide (PubChem CID 24760783) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 24760783 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-2-methoxypyridine-3-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)c1cccnc1OC)C(C)C |
| InChI | InChI=1S/C19H29N3O5/c1-5-6-8-14(11-22(26)12-23)17(24)16(13(2)3)21-18(25)15-9-7-10-20-19(15)27-4/h7,9-10,12-14,16,26H,5-6,8,11H2,1-4H3,(H,21,25)/t14-,16+/m1/s1 |
| InChIKey | WXMUQDQZFLENND-ZBFHGGJFSA-N |
| XLogP | 2.07 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|