C19H29N3O4 — CID 24760862
N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-4-methylpyridine-3-carboxamide (PubChem CID 24760862) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-4-methylpyridine-3-carboxamide.
| Compound Name | N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 24760862 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]-4-methylpyridine-3-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)c1cnccc1C)C(C)C |
| InChI | InChI=1S/C19H29N3O4/c1-5-6-7-15(11-22(26)12-23)18(24)17(13(2)3)21-19(25)16-10-20-9-8-14(16)4/h8-10,12-13,15,17,26H,5-7,11H2,1-4H3,(H,21,25)/t15-,17+/m1/s1 |
| InChIKey | IGDRFIFCLFZRFS-WBVHZDCISA-N |
| XLogP | 2.37 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|