C23H18F2N4O2S — CID 2476139
N'-(2,5-difluorophenyl)sulfonyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide (PubChem CID 2476139) has the molecular formula C23H18F2N4O2S and a molecular weight of 452.49 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)sulfonyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide.
| Compound Name | N'-(2,5-difluorophenyl)sulfonyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 2476139 |
| Molecular Formula | C23H18F2N4O2S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N'-(2,5-difluorophenyl)sulfonyl-N-(5-methyl-2-phenylpyrazol-3-yl)benzenecarboximidamide |
| SMILES | Cc1cc(NC(=NS(=O)(=O)c2cc(F)ccc2F)c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18F2N4O2S/c1-16-14-22(29(27-16)19-10-6-3-7-11-19)26-23(17-8-4-2-5-9-17)28-32(30,31)21-15-18(24)12-13-20(21)25/h2-15H,1H3,(H,26,28) |
| InChIKey | WDIHGAVNVBVXDO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|