C21H34ClN3OS — CID 24761488
3-(3-chloro-4-methoxyphenyl)-1-(3-methylbutyl)-1-(1-propan-2-ylpiperidin-4-yl)thiourea (PubChem CID 24761488) has the molecular formula C21H34ClN3OS and a molecular weight of 412.04 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-1-(3-methylbutyl)-1-(1-propan-2-ylpiperidin-4-yl)thiourea.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-1-(3-methylbutyl)-1-(1-propan-2-ylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 24761488 |
| Molecular Formula | C21H34ClN3OS |
| Molecular Weight | 412.04 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-1-(3-methylbutyl)-1-(1-propan-2-ylpiperidin-4-yl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCC(C)C)C2CCN(C(C)C)CC2)cc1Cl |
| InChI | InChI=1S/C21H34ClN3OS/c1-15(2)8-13-25(18-9-11-24(12-10-18)16(3)4)21(27)23-17-6-7-20(26-5)19(22)14-17/h6-7,14-16,18H,8-13H2,1-5H3,(H,23,27) |
| InChIKey | HNDWHMKTONQBSA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.04 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|