C10H13ClN2O2 — CID 29863
3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea (PubChem CID 29863) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 29863 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
| SMILES | COc1ccc(NC(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O2/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7/h4-6H,1-3H3,(H,12,14) |
| InChIKey | DSRNRYQBBJQVCW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |