C20H13F3N4O4 — CID 24762797
6-(2-aminopyrimidin-4-yl)oxy-N-[3-(trifluoromethoxy)phenyl]-1-benzofuran-3-carboxamide (PubChem CID 24762797) has the molecular formula C20H13F3N4O4 and a molecular weight of 430.34 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-4-yl)oxy-N-[3-(trifluoromethoxy)phenyl]-1-benzofuran-3-carboxamide.
| Compound Name | 6-(2-aminopyrimidin-4-yl)oxy-N-[3-(trifluoromethoxy)phenyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 24762797 |
| Molecular Formula | C20H13F3N4O4 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 6-(2-aminopyrimidin-4-yl)oxy-N-[3-(trifluoromethoxy)phenyl]-1-benzofuran-3-carboxamide |
| SMILES | Nc1nccc(Oc2ccc3c(C(=O)Nc4cccc(OC(F)(F)F)c4)coc3c2)n1 |
| InChI | InChI=1S/C20H13F3N4O4/c21-20(22,23)31-13-3-1-2-11(8-13)26-18(28)15-10-29-16-9-12(4-5-14(15)16)30-17-6-7-25-19(24)27-17/h1-10H,(H,26,28)(H2,24,25,27) |
| InChIKey | CJBHJSLTTDOIKH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |