C22H31NO3 — CID 24762832
[(1R,3E,5S,10R)-3,17,17-trimethyl-7-methylidene-14-oxo-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate (PubChem CID 24762832) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is [(1R,3E,5S,10R)-3,17,17-trimethyl-7-methylidene-14-oxo-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate.
| Compound Name | [(1R,3E,5S,10R)-3,17,17-trimethyl-7-methylidene-14-oxo-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate |
|---|---|
| PubChem CID | 24762832 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [(1R,3E,5S,10R)-3,17,17-trimethyl-7-methylidene-14-oxo-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-5-yl] acetate |
| SMILES | C=C1CC[C@@H]2CCC3=C([C@@H](C/C(C)=C/[C@@H](OC(C)=O)C1)NC3=O)C2(C)C |
| InChI | InChI=1S/C22H31NO3/c1-13-6-7-16-8-9-18-20(22(16,4)5)19(23-21(18)25)12-14(2)11-17(10-13)26-15(3)24/h11,16-17,19H,1,6-10,12H2,2-5H3,(H,23,25)/b14-11+/t16-,17+,19-/m1/s1 |
| InChIKey | XUQXKZLEWMASSE-GLHMNVQHSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|