C23H19BrO — CID 24764092
6-bromo-7,8-dimethyl-2,2-diphenylchromene (PubChem CID 24764092) has the molecular formula C23H19BrO and a molecular weight of 391.31 g/mol. Its IUPAC name is 6-bromo-7,8-dimethyl-2,2-diphenylchromene.
| Compound Name | 6-bromo-7,8-dimethyl-2,2-diphenylchromene |
|---|---|
| PubChem CID | 24764092 |
| Molecular Formula | C23H19BrO |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 6-bromo-7,8-dimethyl-2,2-diphenylchromene |
| SMILES | Cc1c(Br)cc2c(c1C)OC(c1ccccc1)(c1ccccc1)C=C2 |
| InChI | InChI=1S/C23H19BrO/c1-16-17(2)22-18(15-21(16)24)13-14-23(25-22,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15H,1-2H3 |
| InChIKey | WRKSANKDUSNKBA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |