C17H31NO6Si — CID 24766097
(1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one (PubChem CID 24766097) has the molecular formula C17H31NO6Si and a molecular weight of 373.52 g/mol. Its IUPAC name is (1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one.
| Compound Name | (1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one |
|---|---|
| PubChem CID | 24766097 |
| Molecular Formula | C17H31NO6Si |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (1R,2R,6S,9R,11R)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one |
| SMILES | CN1C(=O)O[C@@H]2CO[C@@H]3C[C@@](CO)(CO[Si](C)(C)C(C)(C)C)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C17H31NO6Si/c1-16(2,3)25(5,6)22-10-17(9-19)7-11-14(24-17)13-12(8-21-11)23-15(20)18(13)4/h11-14,19H,7-10H2,1-6H3/t11-,12-,13-,14+,17-/m1/s1 |
| InChIKey | OAGGVSGXQIALLG-MNLSVMLLSA-N |
| XLogP | 1.75 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|