C10H15NO5 — CID 10911341
(1R,2R,6S,9R)-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one (PubChem CID 10911341) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (1R,2R,6S,9R)-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one.
| Compound Name | (1R,2R,6S,9R)-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one |
|---|---|
| PubChem CID | 10911341 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1R,2R,6S,9R)-11-(hydroxymethyl)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecan-4-one |
| SMILES | CN1C(=O)O[C@@H]2CO[C@@H]3CC(CO)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C10H15NO5/c1-11-8-7(16-10(11)13)4-14-6-2-5(3-12)15-9(6)8/h5-9,12H,2-4H2,1H3/t5?,6-,7-,8-,9+/m1/s1 |
| InChIKey | XMVQKYUXKNDGPS-RFLWSCKQSA-N |
| XLogP | -0.65 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |