C9H15NO6 — CID 123285403
6,7,8-trihydroxy-5-(2-hydroxyethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 123285403) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is 6,7,8-trihydroxy-5-(2-hydroxyethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | 6,7,8-trihydroxy-5-(2-hydroxyethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 123285403 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 6,7,8-trihydroxy-5-(2-hydroxyethyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1OCC2C(O)C(O)C(O)C(CCO)N12 |
| InChI | InChI=1S/C9H15NO6/c11-2-1-4-6(12)8(14)7(13)5-3-16-9(15)10(4)5/h4-8,11-14H,1-3H2 |
| InChIKey | KPJOBSAKDWXPLW-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |