C24H42O4SSi2 — CID 24766896
(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3-triethylsilyloxyoxan-4-one (PubChem CID 24766896) has the molecular formula C24H42O4SSi2 and a molecular weight of 482.84 g/mol. Its IUPAC name is (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3-triethylsilyloxyoxan-4-one.
| Compound Name | (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3-triethylsilyloxyoxan-4-one |
|---|---|
| PubChem CID | 24766896 |
| Molecular Formula | C24H42O4SSi2 |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylsulfanyl-3-triethylsilyloxyoxan-4-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C(=O)C[C@@H](Sc2ccccc2)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O4SSi2/c1-9-31(10-2,11-3)28-23-20(25)17-22(29-19-15-13-12-14-16-19)27-21(23)18-26-30(7,8)24(4,5)6/h12-16,21-23H,9-11,17-18H2,1-8H3/t21-,22-,23+/m1/s1 |
| InChIKey | JZEANZHNEDFGQG-ZLNRFVROSA-N |
| XLogP | 6.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|