About lithium 1-hex-1-ynylcyclohexene
lithium 1-hex-1-ynylcyclohexene (PubChem CID 24767056) has the molecular formula C12H17Li
and a molecular weight of 168.21 g/mol. Its IUPAC name is lithium 1-hex-1-ynylcyclohexene.
Molecular Properties
| Compound Name | lithium 1-hex-1-ynylcyclohexene |
| PubChem CID | 24767056 |
| Molecular Formula | C12H17Li |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | lithium 1-hex-1-ynylcyclohexene |
| SMILES | CCCCC#CC1=[C-]CCCC1.[Li+] |
| InChI | InChI=1S/C12H17.Li/c1-2-3-4-6-9-12-10-7-5-8-11-12;/h2-5,7-8,10H2,1H3;/q-1;+1 |
| InChIKey | AYBLCKBQJCNOKE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-hex-1-ynylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-hex-1-ynylcyclohexene?
The IUPAC name of lithium 1-hex-1-ynylcyclohexene (CID 24767056) is lithium 1-hex-1-ynylcyclohexene.
What is the SMILES notation for lithium 1-hex-1-ynylcyclohexene?
The canonical SMILES for lithium 1-hex-1-ynylcyclohexene is CCCCC#CC1=[C-]CCCC1.[Li+].
What is the InChIKey of lithium 1-hex-1-ynylcyclohexene?
The InChIKey is AYBLCKBQJCNOKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17.Li/c1-2-3-4-6-9-12-10-7-5-8-11-12;/h2-5,7-8,10H2,1H3;/q-1;+1.
What are the key properties of lithium 1-hex-1-ynylcyclohexene?
lithium 1-hex-1-ynylcyclohexene has a molecular weight of 168.21 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-hex-1-ynylcyclohexene is sourced from PubChem (CID 24767056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).