C16H24 — CID 13356668
(Z)-7,8-dimethyltetradec-7-en-1,13-diyne (PubChem CID 13356668) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (Z)-7,8-dimethyltetradec-7-en-1,13-diyne.
| Compound Name | (Z)-7,8-dimethyltetradec-7-en-1,13-diyne |
|---|---|
| PubChem CID | 13356668 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (Z)-7,8-dimethyltetradec-7-en-1,13-diyne |
| SMILES | C#CCCCC/C(C)=C(/C)CCCCC#C |
| InChI | InChI=1S/C16H24/c1-5-7-9-11-13-15(3)16(4)14-12-10-8-6-2/h1-2H,7-14H2,3-4H3/b16-15- |
| InChIKey | OPWBGSBKLRQBRS-NXVVXOECSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|