About (E)-7-methyltetradec-7-en-1,13-diyne
(E)-7-methyltetradec-7-en-1,13-diyne (PubChem CID 12714334) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is (E)-7-methyltetradec-7-en-1,13-diyne.
Molecular Properties
| Compound Name | (E)-7-methyltetradec-7-en-1,13-diyne |
| PubChem CID | 12714334 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (E)-7-methyltetradec-7-en-1,13-diyne |
| SMILES | C#CCCCC/C=C(\C)CCCCC#C |
| InChI | InChI=1S/C15H22/c1-4-6-8-10-12-14-15(3)13-11-9-7-5-2/h1-2,14H,6-13H2,3H3/b15-14+ |
| InChIKey | KUSHXCUFBCUGSZ-CCEZHUSRSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-methyltetradec-7-en-1,13-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-methyltetradec-7-en-1,13-diyne?
The IUPAC name of (E)-7-methyltetradec-7-en-1,13-diyne (CID 12714334) is (E)-7-methyltetradec-7-en-1,13-diyne.
What is the SMILES notation for (E)-7-methyltetradec-7-en-1,13-diyne?
The canonical SMILES for (E)-7-methyltetradec-7-en-1,13-diyne is C#CCCCC/C=C(\C)CCCCC#C.
What is the InChIKey of (E)-7-methyltetradec-7-en-1,13-diyne?
The InChIKey is KUSHXCUFBCUGSZ-CCEZHUSRSA-N. The full InChI is InChI=1S/C15H22/c1-4-6-8-10-12-14-15(3)13-11-9-7-5-2/h1-2,14H,6-13H2,3H3/b15-14+.
What are the key properties of (E)-7-methyltetradec-7-en-1,13-diyne?
(E)-7-methyltetradec-7-en-1,13-diyne has a molecular weight of 202.34 g/mol, XLogP of 4.32, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-methyltetradec-7-en-1,13-diyne is sourced from PubChem (CID 12714334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).