C16H22 — CID 10900010
6,8-dimethyltetradeca-6,7-dien-1,13-diyne (PubChem CID 10900010) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 6,8-dimethyltetradeca-6,7-dien-1,13-diyne.
| Compound Name | 6,8-dimethyltetradeca-6,7-dien-1,13-diyne |
|---|---|
| PubChem CID | 10900010 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 6,8-dimethyltetradeca-6,7-dien-1,13-diyne |
| SMILES | C#CCCCCC(C)=C=C(C)CCCC#C |
| InChI | InChI=1S/C16H22/c1-5-7-9-11-13-16(4)14-15(3)12-10-8-6-2/h1-2H,7-13H2,3-4H3 |
| InChIKey | RQRUEHHFCQKULF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|