C16H22 — CID 11117411
14-methylpentadeca-12,13-dien-1,7-diyne (PubChem CID 11117411) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 14-methylpentadeca-12,13-dien-1,7-diyne.
| Compound Name | 14-methylpentadeca-12,13-dien-1,7-diyne |
|---|---|
| PubChem CID | 11117411 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 14-methylpentadeca-12,13-dien-1,7-diyne |
| SMILES | C#CCCCCC#CCCCC=C=C(C)C |
| InChI | InChI=1S/C16H22/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(2)3/h1,14H,5-8,11-13H2,2-3H3 |
| InChIKey | JSHDJZMECOOAMK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|