C18H26 — CID 57170086
4,5,10-triethyldodeca-5,6-dien-1,11-diyne (PubChem CID 57170086) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 4,5,10-triethyldodeca-5,6-dien-1,11-diyne.
| Compound Name | 4,5,10-triethyldodeca-5,6-dien-1,11-diyne |
|---|---|
| PubChem CID | 57170086 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4,5,10-triethyldodeca-5,6-dien-1,11-diyne |
| SMILES | C#CCC(CC)C(=C=CCCC(C#C)CC)CC |
| InChI | InChI=1S/C18H26/c1-6-13-17(9-4)18(10-5)15-12-11-14-16(7-2)8-3/h1-2,12,16-17H,8-11,13-14H2,3-5H3 |
| InChIKey | PMOJZDHDKQSPHW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|