C16H22 — CID 14146889
3,10-diethyldodeca-3,4,8,9-tetraen-6-yne (PubChem CID 14146889) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 3,10-diethyldodeca-3,4,8,9-tetraen-6-yne.
| Compound Name | 3,10-diethyldodeca-3,4,8,9-tetraen-6-yne |
|---|---|
| PubChem CID | 14146889 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3,10-diethyldodeca-3,4,8,9-tetraen-6-yne |
| SMILES | CCC(=C=CC#CC=C=C(CC)CC)CC |
| InChI | InChI=1S/C16H22/c1-5-15(6-2)13-11-9-10-12-14-16(7-3)8-4/h11-12H,5-8H2,1-4H3 |
| InChIKey | DVBXLAFESRQTNH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|