About 7-methylocta-5,6-dien-1-yne
7-methylocta-5,6-dien-1-yne (PubChem CID 91304438) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is 7-methylocta-5,6-dien-1-yne.
Molecular Properties
| Compound Name | 7-methylocta-5,6-dien-1-yne |
| PubChem CID | 91304438 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 7-methylocta-5,6-dien-1-yne |
| SMILES | C#CCCC=C=C(C)C |
| InChI | InChI=1S/C9H12/c1-4-5-6-7-8-9(2)3/h1,7H,5-6H2,2-3H3 |
| InChIKey | PWOBRABGUTYTNP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methylocta-5,6-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylocta-5,6-dien-1-yne?
The IUPAC name of 7-methylocta-5,6-dien-1-yne (CID 91304438) is 7-methylocta-5,6-dien-1-yne.
What is the SMILES notation for 7-methylocta-5,6-dien-1-yne?
The canonical SMILES for 7-methylocta-5,6-dien-1-yne is C#CCCC=C=C(C)C.
What is the InChIKey of 7-methylocta-5,6-dien-1-yne?
The InChIKey is PWOBRABGUTYTNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-4-5-6-7-8-9(2)3/h1,7H,5-6H2,2-3H3.
What are the key properties of 7-methylocta-5,6-dien-1-yne?
7-methylocta-5,6-dien-1-yne has a molecular weight of 120.19 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylocta-5,6-dien-1-yne is sourced from PubChem (CID 91304438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).