C13H20 — CID 11095172
5-butylnona-3,4-dien-1-yne (PubChem CID 11095172) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-butylnona-3,4-dien-1-yne.
| Compound Name | 5-butylnona-3,4-dien-1-yne |
|---|---|
| PubChem CID | 11095172 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-butylnona-3,4-dien-1-yne |
| SMILES | C#CC=C=C(CCCC)CCCC |
| InChI | InChI=1S/C13H20/c1-4-7-10-13(11-8-5-2)12-9-6-3/h1,7H,5-6,8-9,11-12H2,2-3H3 |
| InChIKey | ILPWOABGMQJJBS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|