C17H24 — CID 10846984
3,13-dimethylidenepentadeca-1,14-diyne (PubChem CID 10846984) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 3,13-dimethylidenepentadeca-1,14-diyne.
| Compound Name | 3,13-dimethylidenepentadeca-1,14-diyne |
|---|---|
| PubChem CID | 10846984 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 3,13-dimethylidenepentadeca-1,14-diyne |
| SMILES | C#CC(=C)CCCCCCCCCC(=C)C#C |
| InChI | InChI=1S/C17H24/c1-5-16(3)14-12-10-8-7-9-11-13-15-17(4)6-2/h1-2H,3-4,7-15H2 |
| InChIKey | OYUJEMZAHLCYBL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|