C12H16 — CID 12585185
(Z)-4,5-diethynyloct-4-ene (PubChem CID 12585185) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (Z)-4,5-diethynyloct-4-ene.
| Compound Name | (Z)-4,5-diethynyloct-4-ene |
|---|---|
| PubChem CID | 12585185 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (Z)-4,5-diethynyloct-4-ene |
| SMILES | C#C/C(CCC)=C(\C#C)CCC |
| InChI | InChI=1S/C12H16/c1-5-9-11(7-3)12(8-4)10-6-2/h3-4H,5-6,9-10H2,1-2H3/b12-11- |
| InChIKey | PAHLDLRJYXLQHY-QXMHVHEDSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|