C19H18N6OS — CID 2476709
N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2476709) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2476709 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)Nc3nc(-c4ccc(C)c(C)c4)cs3)nc2n1 |
| InChI | InChI=1S/C19H18N6OS/c1-10-5-6-14(7-11(10)2)15-9-27-19(21-15)23-17(26)16-22-18-20-12(3)8-13(4)25(18)24-16/h5-9H,1-4H3,(H,21,23,26) |
| InChIKey | IGFZPIGRMBJUAW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |