C14H9FO3S — CID 24768258
2-(3-fluoro-4-hydroxyphenyl)-1-benzothiophene-4,6-diol (PubChem CID 24768258) has the molecular formula C14H9FO3S and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxyphenyl)-1-benzothiophene-4,6-diol.
| Compound Name | 2-(3-fluoro-4-hydroxyphenyl)-1-benzothiophene-4,6-diol |
|---|---|
| PubChem CID | 24768258 |
| Molecular Formula | C14H9FO3S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-(3-fluoro-4-hydroxyphenyl)-1-benzothiophene-4,6-diol |
| SMILES | Oc1cc(O)c2cc(-c3ccc(O)c(F)c3)sc2c1 |
| InChI | InChI=1S/C14H9FO3S/c15-10-3-7(1-2-11(10)17)13-6-9-12(18)4-8(16)5-14(9)19-13/h1-6,16-18H |
| InChIKey | FHRLXXNPJFFTRA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |