C20H23BrN4OS — CID 2476843
2-[2-[[5-(4-bromophenyl)-4-(3,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol (PubChem CID 2476843) has the molecular formula C20H23BrN4OS and a molecular weight of 447.40 g/mol. Its IUPAC name is 2-[2-[[5-(4-bromophenyl)-4-(3,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol.
| Compound Name | 2-[2-[[5-(4-bromophenyl)-4-(3,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol |
|---|---|
| PubChem CID | 2476843 |
| Molecular Formula | C20H23BrN4OS |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2-[2-[[5-(4-bromophenyl)-4-(3,5-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylamino]ethanol |
| SMILES | Cc1cc(C)cc(-n2c(SCCNCCO)nnc2-c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H23BrN4OS/c1-14-11-15(2)13-18(12-14)25-19(16-3-5-17(21)6-4-16)23-24-20(25)27-10-8-22-7-9-26/h3-6,11-13,22,26H,7-10H2,1-2H3 |
| InChIKey | RUJYTRPPDCEOML-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|