C28H18Br2N6S2 — CID 4530857
3-(4-bromophenyl)-5-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 4530857) has the molecular formula C28H18Br2N6S2 and a molecular weight of 662.44 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(4-bromophenyl)-5-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4530857 |
| Molecular Formula | C28H18Br2N6S2 |
| Molecular Weight | 662.44 g/mol |
| Exact Mass | 659.94 |
| IUPAC Name | 3-(4-bromophenyl)-5-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]disulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | Brc1ccc(-c2nnc(SSc3nnc(-c4ccc(Br)cc4)n3-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H18Br2N6S2/c29-21-15-11-19(12-16-21)25-31-33-27(35(25)23-7-3-1-4-8-23)37-38-28-34-32-26(20-13-17-22(30)18-14-20)36(28)24-9-5-2-6-10-24/h1-18H |
| InChIKey | ARFARNQWVVVNIW-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.44 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|