C14H9BrN3S- — CID 3115026
5-(4-bromophenyl)-4-phenyl-1,2,4-triazole-3-thiolate (PubChem CID 3115026) has the molecular formula C14H9BrN3S- and a molecular weight of 331.22 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-phenyl-1,2,4-triazole-3-thiolate.
| Compound Name | 5-(4-bromophenyl)-4-phenyl-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 3115026 |
| Molecular Formula | C14H9BrN3S- |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-(4-bromophenyl)-4-phenyl-1,2,4-triazole-3-thiolate |
| SMILES | [S-]c1nnc(-c2ccc(Br)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C14H10BrN3S/c15-11-8-6-10(7-9-11)13-16-17-14(19)18(13)12-4-2-1-3-5-12/h1-9H,(H,17,19)/p-1 |
| InChIKey | VPTPLVZQLRTFJZ-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|