C16H11N4S- — CID 4963878
5-(1H-indol-3-yl)-4-phenyl-1,2,4-triazole-3-thiolate (PubChem CID 4963878) has the molecular formula C16H11N4S- and a molecular weight of 291.36 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-4-phenyl-1,2,4-triazole-3-thiolate.
| Compound Name | 5-(1H-indol-3-yl)-4-phenyl-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 4963878 |
| Molecular Formula | C16H11N4S- |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 5-(1H-indol-3-yl)-4-phenyl-1,2,4-triazole-3-thiolate |
| SMILES | [S-]c1nnc(-c2c[nH]c3ccccc23)n1-c1ccccc1 |
| InChI | InChI=1S/C16H12N4S/c21-16-19-18-15(20(16)11-6-2-1-3-7-11)13-10-17-14-9-5-4-8-12(13)14/h1-10,17H,(H,19,21)/p-1 |
| InChIKey | FIDZHWGHYSFPCS-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|