C10H9BrN3S- — CID 40516405
5-(4-bromophenyl)-4-ethyl-1,2,4-triazole-3-thiolate (PubChem CID 40516405) has the molecular formula C10H9BrN3S- and a molecular weight of 283.17 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-ethyl-1,2,4-triazole-3-thiolate.
| Compound Name | 5-(4-bromophenyl)-4-ethyl-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 40516405 |
| Molecular Formula | C10H9BrN3S- |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 5-(4-bromophenyl)-4-ethyl-1,2,4-triazole-3-thiolate |
| SMILES | CCn1c([S-])nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H10BrN3S/c1-2-14-9(12-13-10(14)15)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3,(H,13,15)/p-1 |
| InChIKey | LJRDNMVJGVAETG-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|