C16H19N3O2S — CID 24768443
N-(2-benzylsulfanyl-6-propoxypyrimidin-4-yl)acetamide (PubChem CID 24768443) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(2-benzylsulfanyl-6-propoxypyrimidin-4-yl)acetamide.
| Compound Name | N-(2-benzylsulfanyl-6-propoxypyrimidin-4-yl)acetamide |
|---|---|
| PubChem CID | 24768443 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(2-benzylsulfanyl-6-propoxypyrimidin-4-yl)acetamide |
| SMILES | CCCOc1cc(NC(C)=O)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C16H19N3O2S/c1-3-9-21-15-10-14(17-12(2)20)18-16(19-15)22-11-13-7-5-4-6-8-13/h4-8,10H,3,9,11H2,1-2H3,(H,17,18,19,20) |
| InChIKey | DYRGWIPSUCOGPQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |