C24H26N4O5S — CID 24769069
[3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl 3,4-dihydroxypiperidine-1-carboxylate (PubChem CID 24769069) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl 3,4-dihydroxypiperidine-1-carboxylate.
| Compound Name | [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl 3,4-dihydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 24769069 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl 3,4-dihydroxypiperidine-1-carboxylate |
| SMILES | N#Cc1c(NC(=O)/C=C/c2cccnc2)sc2c1CCC(COC(=O)N1CCC(O)C(O)C1)C2 |
| InChI | InChI=1S/C24H26N4O5S/c25-11-18-17-5-3-16(14-33-24(32)28-9-7-19(29)20(30)13-28)10-21(17)34-23(18)27-22(31)6-4-15-2-1-8-26-12-15/h1-2,4,6,8,12,16,19-20,29-30H,3,5,7,9-10,13-14H2,(H,27,31)/b6-4+ |
| InChIKey | AFLVPNIJDZKMHI-GQCTYLIASA-N |
| XLogP | 2.34 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|