C29H40N6O5 — CID 24772062
(3S,6S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[(2S)-3,3-dimethyl-2-([1,3]oxazolo[4,5-b]pyridin-2-ylamino)butanoyl]-2,2-dimethyl-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 24772062) has the molecular formula C29H40N6O5 and a molecular weight of 552.68 g/mol. Its IUPAC name is (3S,6S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[(2S)-3,3-dimethyl-2-([1,3]oxazolo[4,5-b]pyridin-2-ylamino)butanoyl]-2,2-dimethyl-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | (3S,6S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[(2S)-3,3-dimethyl-2-([1,3]oxazolo[4,5-b]pyridin-2-ylamino)butanoyl]-2,2-dimethyl-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 24772062 |
| Molecular Formula | C29H40N6O5 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | (3S,6S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-5-[(2S)-3,3-dimethyl-2-([1,3]oxazolo[4,5-b]pyridin-2-ylamino)butanoyl]-2,2-dimethyl-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | CC(C)(C)[C@H](Nc1nc2ncccc2o1)C(=O)N1C[C@]2(C[C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)CC2(C)C |
| InChI | InChI=1S/C29H40N6O5/c1-27(2,3)21(33-26-34-23-19(40-26)10-7-11-31-23)25(39)35-15-29(14-28(29,4)5)13-18(35)24(38)32-17(20(36)22(30)37)12-16-8-6-9-16/h7,10-11,16-18,21H,6,8-9,12-15H2,1-5H3,(H2,30,37)(H,32,38)(H,31,33,34)/t17?,18-,21+,29-/m0/s1 |
| InChIKey | IIBDRNVBRFJZMP-SUWRQHKSSA-N |
| XLogP | 2.80 |
| TPSA | 160.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|