About (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate
(2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate (PubChem CID 24772586) has the molecular formula C19H19NO6
and a molecular weight of 357.36 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate |
| PubChem CID | 24772586 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate |
| SMILES | COC(=O)COC(=O)c1ccc(NC(=O)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO6/c1-24-18(22)13-26-19(23)15-7-9-16(10-8-15)20-17(21)12-25-11-14-5-3-2-4-6-14/h2-10H,11-13H2,1H3,(H,20,21) |
| InChIKey | CIDNNCXDUXBYIR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate?
The IUPAC name of (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate (CID 24772586) is (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate is COC(=O)COC(=O)c1ccc(NC(=O)COCc2ccccc2)cc1.
What is the InChIKey of (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate?
The InChIKey is CIDNNCXDUXBYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO6/c1-24-18(22)13-26-19(23)15-7-9-16(10-8-15)20-17(21)12-25-11-14-5-3-2-4-6-14/h2-10H,11-13H2,1H3,(H,20,21).
What are the key properties of (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate?
(2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate has a molecular weight of 357.36 g/mol, XLogP of 2.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 4-[(2-phenylmethoxyacetyl)amino]benzoate is sourced from PubChem (CID 24772586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).