C14H18N2O3 — CID 24773866
1-methyl-3-(2-propoxypyridine-3-carbonyl)pyrrolidin-2-one (PubChem CID 24773866) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-methyl-3-(2-propoxypyridine-3-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-methyl-3-(2-propoxypyridine-3-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 24773866 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-methyl-3-(2-propoxypyridine-3-carbonyl)pyrrolidin-2-one |
| SMILES | CCCOc1ncccc1C(=O)C1CCN(C)C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-3-9-19-13-10(5-4-7-15-13)12(17)11-6-8-16(2)14(11)18/h4-5,7,11H,3,6,8-9H2,1-2H3 |
| InChIKey | YETRKPFXRAMOKC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|