C10H18N2O2 — CID 67938930
N,N-diethyl-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 67938930) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N,N-diethyl-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 67938930 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N,N-diethyl-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(C)C1=O |
| InChI | InChI=1S/C10H18N2O2/c1-4-12(5-2)10(14)8-6-7-11(3)9(8)13/h8H,4-7H2,1-3H3 |
| InChIKey | JISZKVGEMDDGMR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|