C16H28O6Si — CID 24776625
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)butanoic acid (PubChem CID 24776625) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)butanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 24776625 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)butanoic acid |
| SMILES | CC1(C)OC(=O)C=C(C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H28O6Si/c1-15(2,3)23(6,7)22-12(9-13(17)18)8-11-10-14(19)21-16(4,5)20-11/h10,12H,8-9H2,1-7H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | KEMKSRSXNNJHIM-GFCCVEGCSA-N |
| XLogP | 3.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|