C16H26O6Si — CID 102406891
ethyl 2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate (PubChem CID 102406891) has the molecular formula C16H26O6Si and a molecular weight of 342.46 g/mol. Its IUPAC name is ethyl 2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102406891 |
| Molecular Formula | C16H26O6Si |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | ethyl 2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC(=O)OC1O |
| InChI | InChI=1S/C16H26O6Si/c1-8-20-14(18)10(2)13(11-9-12(17)21-15(11)19)22-23(6,7)16(3,4)5/h9,13,15,19H,2,8H2,1,3-7H3/t13-,15?/m1/s1 |
| InChIKey | SLCCEIRMTNLILT-AFYYWNPRSA-N |
| XLogP | 2.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|