C12H16O2 — CID 24776744
(1S,3R,6R,7S)-3,6,9-trimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 24776744) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1S,3R,6R,7S)-3,6,9-trimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1S,3R,6R,7S)-3,6,9-trimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 24776744 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1S,3R,6R,7S)-3,6,9-trimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | CC1=C[C@H]2[C@]3(C)CO[C@@]2(C)C(=O)[C@H]1C3 |
| InChI | InChI=1S/C12H16O2/c1-7-4-9-11(2)5-8(7)10(13)12(9,3)14-6-11/h4,8-9H,5-6H2,1-3H3/t8-,9-,11-,12+/m0/s1 |
| InChIKey | VEKVCRXVEBPRQS-FSZOTQKASA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|