C22H28BrNO — CID 24779954
3-[1-[4-(2-butylphenyl)but-3-ynyl]pyridin-1-ium-3-yl]propan-1-ol bromide (PubChem CID 24779954) has the molecular formula C22H28BrNO and a molecular weight of 402.38 g/mol. Its IUPAC name is 3-[1-[4-(2-butylphenyl)but-3-ynyl]pyridin-1-ium-3-yl]propan-1-ol bromide.
| Compound Name | 3-[1-[4-(2-butylphenyl)but-3-ynyl]pyridin-1-ium-3-yl]propan-1-ol bromide |
|---|---|
| PubChem CID | 24779954 |
| Molecular Formula | C22H28BrNO |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[1-[4-(2-butylphenyl)but-3-ynyl]pyridin-1-ium-3-yl]propan-1-ol bromide |
| SMILES | CCCCc1ccccc1C#CCC[n+]1cccc(CCCO)c1.[Br-] |
| InChI | InChI=1S/C22H28NO.BrH/c1-2-3-12-21-13-4-5-14-22(21)15-6-7-16-23-17-8-10-20(19-23)11-9-18-24;/h4-5,8,10,13-14,17,19,24H,2-3,7,9,11-12,16,18H2,1H3;1H/q+1;/p-1 |
| InChIKey | UORDJECVJXTMPB-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|